C14H9BrF2N2 — CID 114166471
1-[(3-bromo-2,6-difluorophenyl)methyl]indazole (PubChem CID 114166471) has the molecular formula C14H9BrF2N2 and a molecular weight of 323.14 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]indazole.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]indazole |
|---|---|
| PubChem CID | 114166471 |
| Molecular Formula | C14H9BrF2N2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]indazole |
| SMILES | Fc1ccc(Br)c(F)c1Cn1ncc2ccccc21 |
| InChI | InChI=1S/C14H9BrF2N2/c15-11-5-6-12(16)10(14(11)17)8-19-13-4-2-1-3-9(13)7-18-19/h1-7H,8H2 |
| InChIKey | LTWGEDNTXLKHOA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|