C12H9BrF2N2O2 — CID 106264462
1-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylpyrazole-4-carboxylic acid (PubChem CID 106264462) has the molecular formula C12H9BrF2N2O2 and a molecular weight of 331.12 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylpyrazole-4-carboxylic acid.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106264462 |
| Molecular Formula | C12H9BrF2N2O2 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-5-methylpyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cnn1Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H9BrF2N2O2/c1-6-7(12(18)19)4-16-17(6)5-8-10(14)3-2-9(13)11(8)15/h2-4H,5H2,1H3,(H,18,19) |
| InChIKey | QMFNGOSARLKBIR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|