C13H12BrF2N3O — CID 106269647
2-[(3-bromo-2,6-difluorophenyl)methyl]-5-(dimethylamino)pyridazin-3-one (PubChem CID 106269647) has the molecular formula C13H12BrF2N3O and a molecular weight of 344.16 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-5-(dimethylamino)pyridazin-3-one.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-5-(dimethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 106269647 |
| Molecular Formula | C13H12BrF2N3O |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-5-(dimethylamino)pyridazin-3-one |
| SMILES | CN(C)c1cnn(Cc2c(F)ccc(Br)c2F)c(=O)c1 |
| InChI | InChI=1S/C13H12BrF2N3O/c1-18(2)8-5-12(20)19(17-6-8)7-9-11(15)4-3-10(14)13(9)16/h3-6H,7H2,1-2H3 |
| InChIKey | AOWYSPNUYVXNMT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|