C10H16ClN3O — CID 114394227
2-(3-chloro-2-methylpropyl)-5-(dimethylamino)pyridazin-3-one (PubChem CID 114394227) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-(3-chloro-2-methylpropyl)-5-(dimethylamino)pyridazin-3-one.
| Compound Name | 2-(3-chloro-2-methylpropyl)-5-(dimethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114394227 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(3-chloro-2-methylpropyl)-5-(dimethylamino)pyridazin-3-one |
| SMILES | CC(CCl)Cn1ncc(N(C)C)cc1=O |
| InChI | InChI=1S/C10H16ClN3O/c1-8(5-11)7-14-10(15)4-9(6-12-14)13(2)3/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | XDCNLOGSYHJRFA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|