C12H20BrN3O — CID 114394374
2-(3-bromo-2-methylpropyl)-5-(diethylamino)pyridazin-3-one (PubChem CID 114394374) has the molecular formula C12H20BrN3O and a molecular weight of 302.22 g/mol. Its IUPAC name is 2-(3-bromo-2-methylpropyl)-5-(diethylamino)pyridazin-3-one.
| Compound Name | 2-(3-bromo-2-methylpropyl)-5-(diethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114394374 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-(3-bromo-2-methylpropyl)-5-(diethylamino)pyridazin-3-one |
| SMILES | CCN(CC)c1cnn(CC(C)CBr)c(=O)c1 |
| InChI | InChI=1S/C12H20BrN3O/c1-4-15(5-2)11-6-12(17)16(14-8-11)9-10(3)7-13/h6,8,10H,4-5,7,9H2,1-3H3 |
| InChIKey | SUJGPBKRTHZFNC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|