About 1-ethylindazole;propane
1-ethylindazole;propane (PubChem CID 143188130) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-ethylindazole;propane.
Molecular Properties
| Compound Name | 1-ethylindazole;propane |
| PubChem CID | 143188130 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-ethylindazole;propane |
| SMILES | CCC.CCn1ncc2ccccc21 |
| InChI | InChI=1S/C9H10N2.C3H8/c1-2-11-9-6-4-3-5-8(9)7-10-11;1-3-2/h3-7H,2H2,1H3;3H2,1-2H3 |
| InChIKey | OHERLWNMRZCUDQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethylindazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylindazole;propane?
The IUPAC name of 1-ethylindazole;propane (CID 143188130) is 1-ethylindazole;propane.
What is the SMILES notation for 1-ethylindazole;propane?
The canonical SMILES for 1-ethylindazole;propane is CCC.CCn1ncc2ccccc21.
What is the InChIKey of 1-ethylindazole;propane?
The InChIKey is OHERLWNMRZCUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C3H8/c1-2-11-9-6-4-3-5-8(9)7-10-11;1-3-2/h3-7H,2H2,1H3;3H2,1-2H3.
What are the key properties of 1-ethylindazole;propane?
1-ethylindazole;propane has a molecular weight of 190.29 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylindazole;propane is sourced from PubChem (CID 143188130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).