About 1-ethyl-5-iodoindazole
1-ethyl-5-iodoindazole (PubChem CID 175216814) has the molecular formula C9H9IN2
and a molecular weight of 272.09 g/mol. Its IUPAC name is 1-ethyl-5-iodoindazole.
Molecular Properties
| Compound Name | 1-ethyl-5-iodoindazole |
| PubChem CID | 175216814 |
| Molecular Formula | C9H9IN2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 1-ethyl-5-iodoindazole |
| SMILES | CCn1ncc2cc(I)ccc21 |
| InChI | InChI=1S/C9H9IN2/c1-2-12-9-4-3-8(10)5-7(9)6-11-12/h3-6H,2H2,1H3 |
| InChIKey | POWRRQFMZIXUIK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-5-iodoindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-iodoindazole?
The IUPAC name of 1-ethyl-5-iodoindazole (CID 175216814) is 1-ethyl-5-iodoindazole.
What is the SMILES notation for 1-ethyl-5-iodoindazole?
The canonical SMILES for 1-ethyl-5-iodoindazole is CCn1ncc2cc(I)ccc21.
What is the InChIKey of 1-ethyl-5-iodoindazole?
The InChIKey is POWRRQFMZIXUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IN2/c1-2-12-9-4-3-8(10)5-7(9)6-11-12/h3-6H,2H2,1H3.
What are the key properties of 1-ethyl-5-iodoindazole?
1-ethyl-5-iodoindazole has a molecular weight of 272.09 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-iodoindazole is sourced from PubChem (CID 175216814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).