About 9-ethyl-3,6-diiodocarbazole
9-ethyl-3,6-diiodocarbazole (PubChem CID 4167061) has the molecular formula C14H11I2N
and a molecular weight of 447.06 g/mol. Its IUPAC name is 9-ethyl-3,6-diiodocarbazole.
Molecular Properties
| Compound Name | 9-ethyl-3,6-diiodocarbazole |
| PubChem CID | 4167061 |
| Molecular Formula | C14H11I2N |
| Molecular Weight | 447.06 g/mol |
| Exact Mass | 446.90 |
| IUPAC Name | 9-ethyl-3,6-diiodocarbazole |
| SMILES | CCn1c2ccc(I)cc2c2cc(I)ccc21 |
| InChI | InChI=1S/C14H11I2N/c1-2-17-13-5-3-9(15)7-11(13)12-8-10(16)4-6-14(12)17/h3-8H,2H2,1H3 |
| InChIKey | KMCBWMCQDXPDMI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.06 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-3,6-diiodocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3,6-diiodocarbazole?
The IUPAC name of 9-ethyl-3,6-diiodocarbazole (CID 4167061) is 9-ethyl-3,6-diiodocarbazole.
What is the SMILES notation for 9-ethyl-3,6-diiodocarbazole?
The canonical SMILES for 9-ethyl-3,6-diiodocarbazole is CCn1c2ccc(I)cc2c2cc(I)ccc21.
What is the InChIKey of 9-ethyl-3,6-diiodocarbazole?
The InChIKey is KMCBWMCQDXPDMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11I2N/c1-2-17-13-5-3-9(15)7-11(13)12-8-10(16)4-6-14(12)17/h3-8H,2H2,1H3.
What are the key properties of 9-ethyl-3,6-diiodocarbazole?
9-ethyl-3,6-diiodocarbazole has a molecular weight of 447.06 g/mol, XLogP of 5.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3,6-diiodocarbazole is sourced from PubChem (CID 4167061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).