C13H19N3 — CID 106800346
6-indazol-1-ylhexan-3-amine (PubChem CID 106800346) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 6-indazol-1-ylhexan-3-amine.
| Compound Name | 6-indazol-1-ylhexan-3-amine |
|---|---|
| PubChem CID | 106800346 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 6-indazol-1-ylhexan-3-amine |
| SMILES | CCC(N)CCCn1ncc2ccccc21 |
| InChI | InChI=1S/C13H19N3/c1-2-12(14)7-5-9-16-13-8-4-3-6-11(13)10-15-16/h3-4,6,8,10,12H,2,5,7,9,14H2,1H3 |
| InChIKey | NYYLETRQIKLWNI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |