C16H29N3 — CID 145062231
ethane;2-indazol-1-yl-N,N-dimethylethanamine;propane (PubChem CID 145062231) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;2-indazol-1-yl-N,N-dimethylethanamine;propane.
| Compound Name | ethane;2-indazol-1-yl-N,N-dimethylethanamine;propane |
|---|---|
| PubChem CID | 145062231 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | ethane;2-indazol-1-yl-N,N-dimethylethanamine;propane |
| SMILES | CC.CCC.CN(C)CCn1ncc2ccccc21 |
| InChI | InChI=1S/C11H15N3.C3H8.C2H6/c1-13(2)7-8-14-11-6-4-3-5-10(11)9-12-14;1-3-2;1-2/h3-6,9H,7-8H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | CURMBOHAONKSBT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |