C14H22N4 — CID 62564894
N-(2-indazol-1-ylethyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 62564894) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-(2-indazol-1-ylethyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(2-indazol-1-ylethyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62564894 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N-(2-indazol-1-ylethyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCCn1ncc2ccccc21 |
| InChI | InChI=1S/C14H22N4/c1-17(2)10-5-8-15-9-11-18-14-7-4-3-6-13(14)12-16-18/h3-4,6-7,12,15H,5,8-11H2,1-2H3 |
| InChIKey | KWKQYGUGLDXWPZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|