C12H16ClN3 — CID 141054546
3-(5-chloroindazol-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 141054546) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 3-(5-chloroindazol-1-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5-chloroindazol-1-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 141054546 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-(5-chloroindazol-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCn1ncc2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H16ClN3/c1-15(2)6-3-7-16-12-5-4-11(13)8-10(12)9-14-16/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | QNURQVHIXCRAJO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |