C11H6BrF5N2 — CID 106269524
1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(trifluoromethyl)pyrazole (PubChem CID 106269524) has the molecular formula C11H6BrF5N2 and a molecular weight of 341.08 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 106269524 |
| Molecular Formula | C11H6BrF5N2 |
| Molecular Weight | 341.08 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(trifluoromethyl)pyrazole |
| SMILES | Fc1ccc(Br)c(F)c1Cn1cc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H6BrF5N2/c12-8-1-2-9(13)7(10(8)14)5-19-4-6(3-18-19)11(15,16)17/h1-4H,5H2 |
| InChIKey | HELRCBXZFGLJGQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|