C13H15BrF2N4 — CID 106270782
4-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]butan-1-amine (PubChem CID 106270782) has the molecular formula C13H15BrF2N4 and a molecular weight of 345.19 g/mol. Its IUPAC name is 4-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]butan-1-amine.
| Compound Name | 4-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 106270782 |
| Molecular Formula | C13H15BrF2N4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 4-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]butan-1-amine |
| SMILES | NCCCCc1cn(Cc2c(F)ccc(Br)c2F)nn1 |
| InChI | InChI=1S/C13H15BrF2N4/c14-11-4-5-12(15)10(13(11)16)8-20-7-9(18-19-20)3-1-2-6-17/h4-5,7H,1-3,6,8,17H2 |
| InChIKey | PABQSJWPEXEBJW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|