C10H10F2N4 — CID 114933213
[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanamine (PubChem CID 114933213) has the molecular formula C10H10F2N4 and a molecular weight of 224.21 g/mol. Its IUPAC name is [1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 114933213 |
| Molecular Formula | C10H10F2N4 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(Cc2c(F)cccc2F)nn1 |
| InChI | InChI=1S/C10H10F2N4/c11-9-2-1-3-10(12)8(9)6-16-5-7(4-13)14-15-16/h1-3,5H,4,6,13H2 |
| InChIKey | HGCOJGMUFJCHER-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |