C10H9Cl3N4 — CID 82204215
[1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanamine (PubChem CID 82204215) has the molecular formula C10H9Cl3N4 and a molecular weight of 291.57 g/mol. Its IUPAC name is [1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82204215 |
| Molecular Formula | C10H9Cl3N4 |
| Molecular Weight | 291.57 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | [1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(Cc2c(Cl)ccc(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C10H9Cl3N4/c11-8-1-2-9(12)10(13)7(8)5-17-4-6(3-14)15-16-17/h1-2,4H,3,5,14H2 |
| InChIKey | NKOZMWGPCDDWBO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|