C11H12Cl2N4O — CID 55078167
[1-[2-(2,3-dichlorophenoxy)ethyl]triazol-4-yl]methanamine (PubChem CID 55078167) has the molecular formula C11H12Cl2N4O and a molecular weight of 287.15 g/mol. Its IUPAC name is [1-[2-(2,3-dichlorophenoxy)ethyl]triazol-4-yl]methanamine.
| Compound Name | [1-[2-(2,3-dichlorophenoxy)ethyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 55078167 |
| Molecular Formula | C11H12Cl2N4O |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [1-[2-(2,3-dichlorophenoxy)ethyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(CCOc2cccc(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C11H12Cl2N4O/c12-9-2-1-3-10(11(9)13)18-5-4-17-7-8(6-14)15-16-17/h1-3,7H,4-6,14H2 |
| InChIKey | GKVVFVJPFXYWTF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |