C11H10BrCl2N3O — CID 62402131
4-(bromomethyl)-1-[2-(2,6-dichlorophenoxy)ethyl]triazole (PubChem CID 62402131) has the molecular formula C11H10BrCl2N3O and a molecular weight of 351.03 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[2-(2,6-dichlorophenoxy)ethyl]triazole.
| Compound Name | 4-(bromomethyl)-1-[2-(2,6-dichlorophenoxy)ethyl]triazole |
|---|---|
| PubChem CID | 62402131 |
| Molecular Formula | C11H10BrCl2N3O |
| Molecular Weight | 351.03 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | 4-(bromomethyl)-1-[2-(2,6-dichlorophenoxy)ethyl]triazole |
| SMILES | Clc1cccc(Cl)c1OCCn1cc(CBr)nn1 |
| InChI | InChI=1S/C11H10BrCl2N3O/c12-6-8-7-17(16-15-8)4-5-18-11-9(13)2-1-3-10(11)14/h1-3,7H,4-6H2 |
| InChIKey | JVBCKZOFDPFRQB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.03 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|