C12H14Cl2N4O — CID 116642379
2-[1-[2-(2,6-dichlorophenoxy)ethyl]triazol-4-yl]ethanamine (PubChem CID 116642379) has the molecular formula C12H14Cl2N4O and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-[1-[2-(2,6-dichlorophenoxy)ethyl]triazol-4-yl]ethanamine.
| Compound Name | 2-[1-[2-(2,6-dichlorophenoxy)ethyl]triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 116642379 |
| Molecular Formula | C12H14Cl2N4O |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[1-[2-(2,6-dichlorophenoxy)ethyl]triazol-4-yl]ethanamine |
| SMILES | NCCc1cn(CCOc2c(Cl)cccc2Cl)nn1 |
| InChI | InChI=1S/C12H14Cl2N4O/c13-10-2-1-3-11(14)12(10)19-7-6-18-8-9(4-5-15)16-17-18/h1-3,8H,4-7,15H2 |
| InChIKey | ZTAYVUFIUGDTNW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |