C12H15BrN4O2 — CID 104708429
[1-[2-(2-bromo-4-methoxyphenoxy)ethyl]triazol-4-yl]methanamine (PubChem CID 104708429) has the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. Its IUPAC name is [1-[2-(2-bromo-4-methoxyphenoxy)ethyl]triazol-4-yl]methanamine.
| Compound Name | [1-[2-(2-bromo-4-methoxyphenoxy)ethyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 104708429 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | [1-[2-(2-bromo-4-methoxyphenoxy)ethyl]triazol-4-yl]methanamine |
| SMILES | COc1ccc(OCCn2cc(CN)nn2)c(Br)c1 |
| InChI | InChI=1S/C12H15BrN4O2/c1-18-10-2-3-12(11(13)6-10)19-5-4-17-8-9(7-14)15-16-17/h2-3,6,8H,4-5,7,14H2,1H3 |
| InChIKey | MBJGXYDPNPXICT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |