C11H9F5N4 — CID 116641837
2-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]triazol-4-yl]ethanamine (PubChem CID 116641837) has the molecular formula C11H9F5N4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]triazol-4-yl]ethanamine.
| Compound Name | 2-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 116641837 |
| Molecular Formula | C11H9F5N4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]triazol-4-yl]ethanamine |
| SMILES | NCCc1cn(Cc2c(F)c(F)c(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C11H9F5N4/c12-7-6(8(13)10(15)11(16)9(7)14)4-20-3-5(1-2-17)18-19-20/h3H,1-2,4,17H2 |
| InChIKey | FOVRIKBCHVFPDN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|