C13H16ClFN4 — CID 104539145
4-[1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]butan-1-amine (PubChem CID 104539145) has the molecular formula C13H16ClFN4 and a molecular weight of 282.75 g/mol. Its IUPAC name is 4-[1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]butan-1-amine.
| Compound Name | 4-[1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 104539145 |
| Molecular Formula | C13H16ClFN4 |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[1-[(2-chloro-4-fluorophenyl)methyl]triazol-4-yl]butan-1-amine |
| SMILES | NCCCCc1cn(Cc2ccc(F)cc2Cl)nn1 |
| InChI | InChI=1S/C13H16ClFN4/c14-13-7-11(15)5-4-10(13)8-19-9-12(17-18-19)3-1-2-6-16/h4-5,7,9H,1-3,6,8,16H2 |
| InChIKey | JLAOGODZTQPELI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|