C11H11BrF2N4 — CID 106270777
1-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]ethanamine (PubChem CID 106270777) has the molecular formula C11H11BrF2N4 and a molecular weight of 317.14 g/mol. Its IUPAC name is 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]ethanamine.
| Compound Name | 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 106270777 |
| Molecular Formula | C11H11BrF2N4 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]triazol-4-yl]ethanamine |
| SMILES | CC(N)c1cn(Cc2c(F)ccc(Br)c2F)nn1 |
| InChI | InChI=1S/C11H11BrF2N4/c1-6(15)10-5-18(17-16-10)4-7-9(13)3-2-8(12)11(7)14/h2-3,5-6H,4,15H2,1H3 |
| InChIKey | LSPQXJIEYYXSFO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|