C11H10BrF2N3 — CID 106263562
N-[(3-bromo-2,6-difluorophenyl)methyl]-1-methylpyrazol-4-amine (PubChem CID 106263562) has the molecular formula C11H10BrF2N3 and a molecular weight of 302.12 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-1-methylpyrazol-4-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 106263562 |
| Molecular Formula | C11H10BrF2N3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-methylpyrazol-4-amine |
| SMILES | Cn1cc(NCc2c(F)ccc(Br)c2F)cn1 |
| InChI | InChI=1S/C11H10BrF2N3/c1-17-6-7(4-16-17)15-5-8-10(13)3-2-9(12)11(8)14/h2-4,6,15H,5H2,1H3 |
| InChIKey | MSABMWUKNOWLPH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|