C12H12BrF2N3 — CID 106263665
N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine (PubChem CID 106263665) has the molecular formula C12H12BrF2N3 and a molecular weight of 316.15 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 106263665 |
| Molecular Formula | C12H12BrF2N3 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine |
| SMILES | Cn1ccc(CNCc2c(F)ccc(Br)c2F)n1 |
| InChI | InChI=1S/C12H12BrF2N3/c1-18-5-4-8(17-18)6-16-7-9-11(14)3-2-10(13)12(9)15/h2-5,16H,6-7H2,1H3 |
| InChIKey | POUNLODBXHIZHS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|