C14H17BrF2N4 — CID 106272931
N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-2-methylpropan-2-amine (PubChem CID 106272931) has the molecular formula C14H17BrF2N4 and a molecular weight of 359.22 g/mol. Its IUPAC name is N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 106272931 |
| Molecular Formula | C14H17BrF2N4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ncn(Cc2c(F)ccc(Br)c2F)n1 |
| InChI | InChI=1S/C14H17BrF2N4/c1-14(2,3)19-6-12-18-8-21(20-12)7-9-11(16)5-4-10(15)13(9)17/h4-5,8,19H,6-7H2,1-3H3 |
| InChIKey | CJLBKWWZDLMVPF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|