C15H17BrF2N2 — CID 106265038
1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-N-methylpropan-1-amine (PubChem CID 106265038) has the molecular formula C15H17BrF2N2 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-N-methylpropan-1-amine.
| Compound Name | 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 106265038 |
| Molecular Formula | C15H17BrF2N2 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1ccn(Cc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C15H17BrF2N2/c1-3-14(19-2)10-6-7-20(8-10)9-11-13(17)5-4-12(16)15(11)18/h4-8,14,19H,3,9H2,1-2H3 |
| InChIKey | XTFXOCYOUTUSQB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|