C15H17BrF2N2 — CID 106265022
N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine (PubChem CID 106265022) has the molecular formula C15H17BrF2N2 and a molecular weight of 343.22 g/mol. Its IUPAC name is N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106265022 |
| Molecular Formula | C15H17BrF2N2 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccn(Cc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C15H17BrF2N2/c1-2-6-19-8-11-5-7-20(9-11)10-12-14(17)4-3-13(16)15(12)18/h3-5,7,9,19H,2,6,8,10H2,1H3 |
| InChIKey | IXBYIBUKEKRGKR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|