C16H20ClFN2 — CID 79109903
1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine (PubChem CID 79109903) has the molecular formula C16H20ClFN2 and a molecular weight of 294.80 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 79109903 |
| Molecular Formula | C16H20ClFN2 |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine |
| SMILES | CCCC(NC)c1ccn(Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C16H20ClFN2/c1-3-5-16(19-2)12-8-9-20(10-12)11-13-14(17)6-4-7-15(13)18/h4,6-10,16,19H,3,5,11H2,1-2H3 |
| InChIKey | OJYDEFBYIVDEOS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |