C15H18F2N2 — CID 114930925
1-[1-[(2,6-difluorophenyl)methyl]pyrrol-3-yl]butan-1-amine (PubChem CID 114930925) has the molecular formula C15H18F2N2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[1-[(2,6-difluorophenyl)methyl]pyrrol-3-yl]butan-1-amine.
| Compound Name | 1-[1-[(2,6-difluorophenyl)methyl]pyrrol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 114930925 |
| Molecular Formula | C15H18F2N2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-[1-[(2,6-difluorophenyl)methyl]pyrrol-3-yl]butan-1-amine |
| SMILES | CCCC(N)c1ccn(Cc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C15H18F2N2/c1-2-4-15(18)11-7-8-19(9-11)10-12-13(16)5-3-6-14(12)17/h3,5-9,15H,2,4,10,18H2,1H3 |
| InChIKey | LFQCMVQHJQWTAK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |