C13H24N2 — CID 79107801
1-[1-(3-methylbutyl)pyrrol-3-yl]butan-1-amine (PubChem CID 79107801) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-[1-(3-methylbutyl)pyrrol-3-yl]butan-1-amine.
| Compound Name | 1-[1-(3-methylbutyl)pyrrol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 79107801 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-[1-(3-methylbutyl)pyrrol-3-yl]butan-1-amine |
| SMILES | CCCC(N)c1ccn(CCC(C)C)c1 |
| InChI | InChI=1S/C13H24N2/c1-4-5-13(14)12-7-9-15(10-12)8-6-11(2)3/h7,9-11,13H,4-6,8,14H2,1-3H3 |
| InChIKey | ZJYWFMDTTVMJLN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |