C17H24N2O2 — CID 79108388
1-[1-[2-(2-methoxyphenoxy)ethyl]pyrrol-3-yl]butan-1-amine (PubChem CID 79108388) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[1-[2-(2-methoxyphenoxy)ethyl]pyrrol-3-yl]butan-1-amine.
| Compound Name | 1-[1-[2-(2-methoxyphenoxy)ethyl]pyrrol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 79108388 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[1-[2-(2-methoxyphenoxy)ethyl]pyrrol-3-yl]butan-1-amine |
| SMILES | CCCC(N)c1ccn(CCOc2ccccc2OC)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-6-15(18)14-9-10-19(13-14)11-12-21-17-8-5-4-7-16(17)20-2/h4-5,7-10,13,15H,3,6,11-12,18H2,1-2H3 |
| InChIKey | YCLXHJDQUBGAQD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |