C16H24N2S — CID 79109274
1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine (PubChem CID 79109274) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine.
| Compound Name | 1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 79109274 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]-N-methylbutan-1-amine |
| SMILES | CCCC(NC)c1ccn(Cc2ccc(CC)s2)c1 |
| InChI | InChI=1S/C16H24N2S/c1-4-6-16(17-3)13-9-10-18(11-13)12-15-8-7-14(5-2)19-15/h7-11,16-17H,4-6,12H2,1-3H3 |
| InChIKey | KPVKAKPPMLFCGL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |