C13H18N2S — CID 79102092
1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]ethanamine (PubChem CID 79102092) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]ethanamine.
| Compound Name | 1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 79102092 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-3-yl]ethanamine |
| SMILES | CCc1ccc(Cn2ccc(C(C)N)c2)s1 |
| InChI | InChI=1S/C13H18N2S/c1-3-12-4-5-13(16-12)9-15-7-6-11(8-15)10(2)14/h4-8,10H,3,9,14H2,1-2H3 |
| InChIKey | MRNLZAQCAWKMEU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |