C13H7BrF5NO — CID 106264971
1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-2,2,2-trifluoroethanone (PubChem CID 106264971) has the molecular formula C13H7BrF5NO and a molecular weight of 368.10 g/mol. Its IUPAC name is 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 106264971 |
| Molecular Formula | C13H7BrF5NO |
| Molecular Weight | 368.10 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 1-[1-[(3-bromo-2,6-difluorophenyl)methyl]pyrrol-3-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccn(Cc2c(F)ccc(Br)c2F)c1)C(F)(F)F |
| InChI | InChI=1S/C13H7BrF5NO/c14-9-1-2-10(15)8(11(9)16)6-20-4-3-7(5-20)12(21)13(17,18)19/h1-5H,6H2 |
| InChIKey | REKJDTVFDIEDSY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.10 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|