C12H15BrClF2N — CID 106272320
N-[(3-bromo-2,6-difluorophenyl)methyl]-1-chloro-2-methylbutan-2-amine (PubChem CID 106272320) has the molecular formula C12H15BrClF2N and a molecular weight of 326.61 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-1-chloro-2-methylbutan-2-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-chloro-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 106272320 |
| Molecular Formula | C12H15BrClF2N |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-1-chloro-2-methylbutan-2-amine |
| SMILES | CCC(C)(CCl)NCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H15BrClF2N/c1-3-12(2,7-14)17-6-8-10(15)5-4-9(13)11(8)16/h4-5,17H,3,6-7H2,1-2H3 |
| InChIKey | OPLUQVMJBABDME-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|