C12H15BrF2O — CID 106265112
3-[(3-bromo-2,6-difluorophenyl)methyl]pentan-3-ol (PubChem CID 106265112) has the molecular formula C12H15BrF2O and a molecular weight of 293.15 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methyl]pentan-3-ol.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]pentan-3-ol |
|---|---|
| PubChem CID | 106265112 |
| Molecular Formula | C12H15BrF2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H15BrF2O/c1-3-12(16,4-2)7-8-10(14)6-5-9(13)11(8)15/h5-6,16H,3-4,7H2,1-2H3 |
| InChIKey | MIJLMODXCRFQAG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|