C14H20BrF2N — CID 114166681
2-[(3-bromo-2,6-difluorophenyl)methyl]-N,2-dimethylpentan-1-amine (PubChem CID 114166681) has the molecular formula C14H20BrF2N and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-N,2-dimethylpentan-1-amine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-N,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114166681 |
| Molecular Formula | C14H20BrF2N |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-N,2-dimethylpentan-1-amine |
| SMILES | CCCC(C)(CNC)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H20BrF2N/c1-4-7-14(2,9-18-3)8-10-12(16)6-5-11(15)13(10)17/h5-6,18H,4,7-9H2,1-3H3 |
| InChIKey | NBZKZLWPNDWCMK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|