C13H18BrF2N — CID 106271309
2-[(3-bromo-2,6-difluorophenyl)methyl]-2-ethylbutan-1-amine (PubChem CID 106271309) has the molecular formula C13H18BrF2N and a molecular weight of 306.19 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-ethylbutan-1-amine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 106271309 |
| Molecular Formula | C13H18BrF2N |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-ethylbutan-1-amine |
| SMILES | CCC(CC)(CN)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H18BrF2N/c1-3-13(4-2,8-17)7-9-11(15)6-5-10(14)12(9)16/h5-6H,3-4,7-8,17H2,1-2H3 |
| InChIKey | DNKYCOQNDLLLGY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|