C15H22BrF2N — CID 106271326
3-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-2,2-dimethylpropan-1-amine (PubChem CID 106271326) has the molecular formula C15H22BrF2N and a molecular weight of 334.25 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-2,2-dimethylpropan-1-amine.
| Compound Name | 3-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 106271326 |
| Molecular Formula | C15H22BrF2N |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(CNC(C)(C)C)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H22BrF2N/c1-14(2,3)19-9-15(4,5)8-10-12(17)7-6-11(16)13(10)18/h6-7,19H,8-9H2,1-5H3 |
| InChIKey | OBWJCJLCOUGDQP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|