C16H24BrF2N — CID 106273338
4-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine (PubChem CID 106273338) has the molecular formula C16H24BrF2N and a molecular weight of 348.28 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 106273338 |
| Molecular Formula | C16H24BrF2N |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(CCNC(C)(C)C)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C16H24BrF2N/c1-15(2,3)20-9-8-16(4,5)10-11-13(18)7-6-12(17)14(11)19/h6-7,20H,8-10H2,1-5H3 |
| InChIKey | XINKEJRILKSNCP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|