C14H18BrF2N — CID 106943833
(E)-4-(3-bromo-2,6-difluorophenyl)-N-tert-butylbut-3-en-1-amine (PubChem CID 106943833) has the molecular formula C14H18BrF2N and a molecular weight of 318.21 g/mol. Its IUPAC name is (E)-4-(3-bromo-2,6-difluorophenyl)-N-tert-butylbut-3-en-1-amine.
| Compound Name | (E)-4-(3-bromo-2,6-difluorophenyl)-N-tert-butylbut-3-en-1-amine |
|---|---|
| PubChem CID | 106943833 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (E)-4-(3-bromo-2,6-difluorophenyl)-N-tert-butylbut-3-en-1-amine |
| SMILES | CC(C)(C)NCC/C=C/c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H18BrF2N/c1-14(2,3)18-9-5-4-6-10-12(16)8-7-11(15)13(10)17/h4,6-8,18H,5,9H2,1-3H3/b6-4+ |
| InChIKey | NLJIYIWDAGXGCK-GQCTYLIASA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|