C15H20F3N — CID 79599160
N-tert-butyl-4-[3-(trifluoromethyl)phenyl]but-3-en-1-amine (PubChem CID 79599160) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is N-tert-butyl-4-[3-(trifluoromethyl)phenyl]but-3-en-1-amine.
| Compound Name | N-tert-butyl-4-[3-(trifluoromethyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 79599160 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-tert-butyl-4-[3-(trifluoromethyl)phenyl]but-3-en-1-amine |
| SMILES | CC(C)(C)NCCC=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3N/c1-14(2,3)19-10-5-4-7-12-8-6-9-13(11-12)15(16,17)18/h4,6-9,11,19H,5,10H2,1-3H3 |
| InChIKey | ZVLJIWOPWWWKJG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|