C20H25N — CID 79592735
N-tert-butyl-4-(4-phenylphenyl)but-3-en-1-amine (PubChem CID 79592735) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is N-tert-butyl-4-(4-phenylphenyl)but-3-en-1-amine.
| Compound Name | N-tert-butyl-4-(4-phenylphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 79592735 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-tert-butyl-4-(4-phenylphenyl)but-3-en-1-amine |
| SMILES | CC(C)(C)NCCC=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N/c1-20(2,3)21-16-8-7-9-17-12-14-19(15-13-17)18-10-5-4-6-11-18/h4-7,9-15,21H,8,16H2,1-3H3 |
| InChIKey | FEMFLLREKCUCHU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|