C21H25FN2O3 — CID 123808194
4-fluoro-N,3-dihydroxy-2,3-dimethyl-2-[3-(4-phenylphenyl)prop-2-enylamino]butanamide (PubChem CID 123808194) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is 4-fluoro-N,3-dihydroxy-2,3-dimethyl-2-[3-(4-phenylphenyl)prop-2-enylamino]butanamide.
| Compound Name | 4-fluoro-N,3-dihydroxy-2,3-dimethyl-2-[3-(4-phenylphenyl)prop-2-enylamino]butanamide |
|---|---|
| PubChem CID | 123808194 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-fluoro-N,3-dihydroxy-2,3-dimethyl-2-[3-(4-phenylphenyl)prop-2-enylamino]butanamide |
| SMILES | CC(O)(CF)C(C)(NCC=Cc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C21H25FN2O3/c1-20(26,15-22)21(2,19(25)24-27)23-14-6-7-16-10-12-18(13-11-16)17-8-4-3-5-9-17/h3-13,23,26-27H,14-15H2,1-2H3,(H,24,25) |
| InChIKey | NOINDOGDPXKRDP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|