C22H31NO3 — CID 144791814
N,3-dihydroxy-2,3-dimethyl-2-[2-(4-phenylphenyl)ethyl]butanamide;ethane (PubChem CID 144791814) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is N,3-dihydroxy-2,3-dimethyl-2-[2-(4-phenylphenyl)ethyl]butanamide;ethane.
| Compound Name | N,3-dihydroxy-2,3-dimethyl-2-[2-(4-phenylphenyl)ethyl]butanamide;ethane |
|---|---|
| PubChem CID | 144791814 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N,3-dihydroxy-2,3-dimethyl-2-[2-(4-phenylphenyl)ethyl]butanamide;ethane |
| SMILES | CC.CC(C)(O)C(C)(CCc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H25NO3.C2H6/c1-19(2,23)20(3,18(22)21-24)14-13-15-9-11-17(12-10-15)16-7-5-4-6-8-16;1-2/h4-12,23-24H,13-14H2,1-3H3,(H,21,22);1-2H3 |
| InChIKey | KAOZSSRMHFXGBP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|