C18H19Cl2NO4S — CID 90684268
4-[4-(2,3-dichlorophenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90684268) has the molecular formula C18H19Cl2NO4S and a molecular weight of 416.33 g/mol. Its IUPAC name is 4-[4-(2,3-dichlorophenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[4-(2,3-dichlorophenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90684268 |
| Molecular Formula | C18H19Cl2NO4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-[4-(2,3-dichlorophenyl)phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCc1ccc(-c2cccc(Cl)c2Cl)cc1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C18H19Cl2NO4S/c1-18(17(22)21-23,26(2,24)25)11-10-12-6-8-13(9-7-12)14-4-3-5-15(19)16(14)20/h3-9,23H,10-11H2,1-2H3,(H,21,22) |
| InChIKey | IWEGJZNHYOWULU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|