C21H27NO5S — CID 91663429
4-[4-[(2-ethylphenyl)methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 91663429) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-[4-[(2-ethylphenyl)methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[4-[(2-ethylphenyl)methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 91663429 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-[4-[(2-ethylphenyl)methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CCc1ccccc1COc1ccc(CCC(C)(C(=O)NO)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-4-17-7-5-6-8-18(17)15-27-19-11-9-16(10-12-19)13-14-21(2,20(23)22-24)28(3,25)26/h5-12,24H,4,13-15H2,1-3H3,(H,22,23) |
| InChIKey | GSSSJYHNEWVTFQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|