C23H27FN2O6S — CID 91663378
4-[4-[[2-(2-fluorophenyl)-5-methyl-2,3-dihydro-1,3-oxazol-4-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 91663378) has the molecular formula C23H27FN2O6S and a molecular weight of 478.54 g/mol. Its IUPAC name is 4-[4-[[2-(2-fluorophenyl)-5-methyl-2,3-dihydro-1,3-oxazol-4-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[4-[[2-(2-fluorophenyl)-5-methyl-2,3-dihydro-1,3-oxazol-4-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 91663378 |
| Molecular Formula | C23H27FN2O6S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 4-[4-[[2-(2-fluorophenyl)-5-methyl-2,3-dihydro-1,3-oxazol-4-yl]methoxy]phenyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC1=C(COc2ccc(CCC(C)(C(=O)NO)S(C)(=O)=O)cc2)NC(c2ccccc2F)O1 |
| InChI | InChI=1S/C23H27FN2O6S/c1-15-20(25-21(32-15)18-6-4-5-7-19(18)24)14-31-17-10-8-16(9-11-17)12-13-23(2,22(27)26-28)33(3,29)30/h4-11,21,25,28H,12-14H2,1-3H3,(H,26,27) |
| InChIKey | KLFTWJZFKVEJRY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|