C21H26F2N2O2 — CID 123709297
4-fluoro-3-(fluoromethyl)-N-hydroxy-2-methyl-2-[3-(4-phenylphenyl)propylamino]butanamide (PubChem CID 123709297) has the molecular formula C21H26F2N2O2 and a molecular weight of 376.45 g/mol. Its IUPAC name is 4-fluoro-3-(fluoromethyl)-N-hydroxy-2-methyl-2-[3-(4-phenylphenyl)propylamino]butanamide.
| Compound Name | 4-fluoro-3-(fluoromethyl)-N-hydroxy-2-methyl-2-[3-(4-phenylphenyl)propylamino]butanamide |
|---|---|
| PubChem CID | 123709297 |
| Molecular Formula | C21H26F2N2O2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-fluoro-3-(fluoromethyl)-N-hydroxy-2-methyl-2-[3-(4-phenylphenyl)propylamino]butanamide |
| SMILES | CC(NCCCc1ccc(-c2ccccc2)cc1)(C(=O)NO)C(CF)CF |
| InChI | InChI=1S/C21H26F2N2O2/c1-21(20(26)25-27,19(14-22)15-23)24-13-5-6-16-9-11-18(12-10-16)17-7-3-2-4-8-17/h2-4,7-12,19,24,27H,5-6,13-15H2,1H3,(H,25,26) |
| InChIKey | JUZIMCKWQRRBGM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|